C17H22N4O3 — CID 71938098
1-(1,3-benzodioxol-4-ylmethyl)-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea (PubChem CID 71938098) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-4-ylmethyl)-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea.
| Compound Name | 1-(1,3-benzodioxol-4-ylmethyl)-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 71938098 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-(1,3-benzodioxol-4-ylmethyl)-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea |
| SMILES | Cc1cc(C)n(CCCNC(=O)NCc2cccc3c2OCO3)n1 |
| InChI | InChI=1S/C17H22N4O3/c1-12-9-13(2)21(20-12)8-4-7-18-17(22)19-10-14-5-3-6-15-16(14)24-11-23-15/h3,5-6,9H,4,7-8,10-11H2,1-2H3,(H2,18,19,22) |
| InChIKey | BAFADSGOFQBOSI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|