C24H25N5O2 — CID 25382523
N-[[3-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-4-yl]methyl]-2-(3,5-dimethylpyrazol-1-yl)ethanamine (PubChem CID 25382523) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[[3-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-4-yl]methyl]-2-(3,5-dimethylpyrazol-1-yl)ethanamine.
| Compound Name | N-[[3-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-4-yl]methyl]-2-(3,5-dimethylpyrazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 25382523 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[[3-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-4-yl]methyl]-2-(3,5-dimethylpyrazol-1-yl)ethanamine |
| SMILES | Cc1cc(C)n(CCNCc2cn(-c3ccccc3)nc2-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C24H25N5O2/c1-17-12-18(2)28(26-17)11-10-25-14-20-15-29(21-6-4-3-5-7-21)27-24(20)19-8-9-22-23(13-19)31-16-30-22/h3-9,12-13,15,25H,10-11,14,16H2,1-2H3 |
| InChIKey | HWWVDYHDFAVVJE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|