C20H21N3O2S — CID 42214502
N-[[3-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-4-yl]methyl]-2-methylsulfanylethanamine (PubChem CID 42214502) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[[3-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-4-yl]methyl]-2-methylsulfanylethanamine.
| Compound Name | N-[[3-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-4-yl]methyl]-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 42214502 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[[3-(1,3-benzodioxol-5-yl)-1-phenylpyrazol-4-yl]methyl]-2-methylsulfanylethanamine |
| SMILES | CSCCNCc1cn(-c2ccccc2)nc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H21N3O2S/c1-26-10-9-21-12-16-13-23(17-5-3-2-4-6-17)22-20(16)15-7-8-18-19(11-15)25-14-24-18/h2-8,11,13,21H,9-10,12,14H2,1H3 |
| InChIKey | UPUXXPLHEXBOOS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|