C25H26FN5O3 — CID 24516173
4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]butanamide (PubChem CID 24516173) has the molecular formula C25H26FN5O3 and a molecular weight of 463.51 g/mol. Its IUPAC name is 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]butanamide.
| Compound Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]butanamide |
|---|---|
| PubChem CID | 24516173 |
| Molecular Formula | C25H26FN5O3 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]butanamide |
| SMILES | CC1(C)NC(=O)N(CCCC(=O)NCc2cn(-c3ccccc3)nc2-c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C25H26FN5O3/c1-25(2)23(33)30(24(34)28-25)14-6-9-21(32)27-15-18-16-31(20-7-4-3-5-8-20)29-22(18)17-10-12-19(26)13-11-17/h3-5,7-8,10-13,16H,6,9,14-15H2,1-2H3,(H,27,32)(H,28,34) |
| InChIKey | VZQATRGQZPYWGK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|