C29H38N4O — CID 46295820
N-[3-[cyclohexyl(methyl)amino]propyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]propanamide (PubChem CID 46295820) has the molecular formula C29H38N4O and a molecular weight of 458.65 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)amino]propyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]propanamide.
| Compound Name | N-[3-[cyclohexyl(methyl)amino]propyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 46295820 |
| Molecular Formula | C29H38N4O |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)amino]propyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]propanamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2CCC(=O)NCCCN(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H38N4O/c1-23-14-16-24(17-15-23)29-25(22-33(31-29)27-12-7-4-8-13-27)18-19-28(34)30-20-9-21-32(2)26-10-5-3-6-11-26/h4,7-8,12-17,22,26H,3,5-6,9-11,18-21H2,1-2H3,(H,30,34) |
| InChIKey | HZXSUZLJMGCWKL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|