C30H34N4O — CID 46295810
N-[3-[benzyl(methyl)amino]propyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]propanamide (PubChem CID 46295810) has the molecular formula C30H34N4O and a molecular weight of 466.63 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]propanamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 46295810 |
| Molecular Formula | C30H34N4O |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]propanamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2CCC(=O)NCCCN(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H34N4O/c1-24-14-16-26(17-15-24)30-27(23-34(32-30)28-12-7-4-8-13-28)18-19-29(35)31-20-9-21-33(2)22-25-10-5-3-6-11-25/h3-8,10-17,23H,9,18-22H2,1-2H3,(H,31,35) |
| InChIKey | GQGLCICRAYMELE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|