C24H27N3O2 — CID 120509853
4-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120509853) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120509853 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 4-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylamino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2CNC2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-17-7-9-18(10-8-17)23-20(16-27(26-23)22-5-3-2-4-6-22)15-25-21-13-11-19(12-14-21)24(28)29/h2-10,16,19,21,25H,11-15H2,1H3,(H,28,29) |
| InChIKey | KFMDPPXITSANFJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |