C22H26N4 — CID 96998820
(3R)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-methylpiperidin-3-amine (PubChem CID 96998820) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is (3R)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-methylpiperidin-3-amine.
| Compound Name | (3R)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 96998820 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (3R)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-methylpiperidin-3-amine |
| SMILES | CN1CCC[C@@H](NCc2cn(-c3ccccc3)nc2-c2ccccc2)C1 |
| InChI | InChI=1S/C22H26N4/c1-25-14-8-11-20(17-25)23-15-19-16-26(21-12-6-3-7-13-21)24-22(19)18-9-4-2-5-10-18/h2-7,9-10,12-13,16,20,23H,8,11,14-15,17H2,1H3/t20-/m1/s1 |
| InChIKey | OSEDBLONOFBGNJ-HXUWFJFHSA-N |
| XLogP | 3.72 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |