C24H29N5 — CID 75099598
1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-pyrazolidin-3-ylpiperidine (PubChem CID 75099598) has the molecular formula C24H29N5 and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-pyrazolidin-3-ylpiperidine.
| Compound Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-pyrazolidin-3-ylpiperidine |
|---|---|
| PubChem CID | 75099598 |
| Molecular Formula | C24H29N5 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-pyrazolidin-3-ylpiperidine |
| SMILES | c1ccc(-c2nn(-c3ccccc3)cc2CN2CCCC(C3CCNN3)C2)cc1 |
| InChI | InChI=1S/C24H29N5/c1-3-8-19(9-4-1)24-21(18-29(27-24)22-11-5-2-6-12-22)17-28-15-7-10-20(16-28)23-13-14-25-26-23/h1-6,8-9,11-12,18,20,23,25-26H,7,10,13-17H2 |
| InChIKey | UZUANGRGPIBFLY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |