C22H24FN3O — CID 25486900
1-[[3-(4-fluorophenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]piperidin-4-ol (PubChem CID 25486900) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is 1-[[3-(4-fluorophenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]piperidin-4-ol.
| Compound Name | 1-[[3-(4-fluorophenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 25486900 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-[[3-(4-fluorophenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]piperidin-4-ol |
| SMILES | Cc1ccc(-n2cc(CN3CCC(O)CC3)c(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C22H24FN3O/c1-16-2-8-20(9-3-16)26-15-18(14-25-12-10-21(27)11-13-25)22(24-26)17-4-6-19(23)7-5-17/h2-9,15,21,27H,10-14H2,1H3 |
| InChIKey | KXNHITVAVVJYLP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |