C17H16FN3 — CID 28910918
[1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazol-4-yl]methanamine (PubChem CID 28910918) has the molecular formula C17H16FN3 and a molecular weight of 281.33 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazol-4-yl]methanamine.
| Compound Name | [1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazol-4-yl]methanamine |
|---|---|
| PubChem CID | 28910918 |
| Molecular Formula | C17H16FN3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazol-4-yl]methanamine |
| SMILES | Cc1ccc(-c2nn(-c3ccc(F)cc3)cc2CN)cc1 |
| InChI | InChI=1S/C17H16FN3/c1-12-2-4-13(5-3-12)17-14(10-19)11-21(20-17)16-8-6-15(18)7-9-16/h2-9,11H,10,19H2,1H3 |
| InChIKey | UCFARJGWKVVBTQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |