C24H31N5 — CID 119122665
N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]-1-(1-propylpiperidin-4-yl)methanamine (PubChem CID 119122665) has the molecular formula C24H31N5 and a molecular weight of 389.55 g/mol. Its IUPAC name is N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]-1-(1-propylpiperidin-4-yl)methanamine.
| Compound Name | N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]-1-(1-propylpiperidin-4-yl)methanamine |
|---|---|
| PubChem CID | 119122665 |
| Molecular Formula | C24H31N5 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]-1-(1-propylpiperidin-4-yl)methanamine |
| SMILES | CCCN1CCC(CNCc2cn(-c3ccccc3)nc2-c2ccncc2)CC1 |
| InChI | InChI=1S/C24H31N5/c1-2-14-28-15-10-20(11-16-28)17-26-18-22-19-29(23-6-4-3-5-7-23)27-24(22)21-8-12-25-13-9-21/h3-9,12-13,19-20,26H,2,10-11,14-18H2,1H3 |
| InChIKey | UPSOYXAFDNPXNI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |