C24H27N5O2 — CID 100610825
2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxo-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]acetamide (PubChem CID 100610825) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxo-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]acetamide.
| Compound Name | 2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxo-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 100610825 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxo-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]acetamide |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(=O)C(=O)NCc1cn(-c2ccccc2)nc1-c1ccncc1 |
| InChI | InChI=1S/C24H27N5O2/c1-17-7-6-8-18(2)29(17)24(31)23(30)26-15-20-16-28(21-9-4-3-5-10-21)27-22(20)19-11-13-25-14-12-19/h3-5,9-14,16-18H,6-8,15H2,1-2H3,(H,26,30)/t17-,18+ |
| InChIKey | FWPXALKDSQKIJC-HDICACEKSA-N |
| XLogP | 3.34 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|