C29H29N5O3 — CID 60604630
benzyl 4-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 60604630) has the molecular formula C29H29N5O3 and a molecular weight of 495.58 g/mol. Its IUPAC name is benzyl 4-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 60604630 |
| Molecular Formula | C29H29N5O3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | benzyl 4-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | O=C(NCc1cn(-c2ccccc2)nc1-c1ccncc1)C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C29H29N5O3/c35-28(24-13-17-33(18-14-24)29(36)37-21-22-7-3-1-4-8-22)31-19-25-20-34(26-9-5-2-6-10-26)32-27(25)23-11-15-30-16-12-23/h1-12,15-16,20,24H,13-14,17-19,21H2,(H,31,35) |
| InChIKey | SXSRCNNPTDQYOV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |