C29H29N5O2 — CID 27841140
4-N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 27841140) has the molecular formula C29H29N5O2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 4-N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 27841140 |
| Molecular Formula | C29H29N5O2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 4-N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | O=C(NCc1cn(-c2ccccc2)nc1-c1ccccc1)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C29H29N5O2/c35-28(23-16-18-33(19-17-23)29(36)31-25-12-6-2-7-13-25)30-20-24-21-34(26-14-8-3-9-15-26)32-27(24)22-10-4-1-5-11-22/h1-15,21,23H,16-20H2,(H,30,35)(H,31,36) |
| InChIKey | CMEDVLPDNAEHEV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |