C22H31N3O2 — CID 120509648
4-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-4-yl]methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120509648) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-4-yl]methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-4-yl]methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120509648 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 4-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-4-yl]methylamino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(-n2cc(CNC3CCC(C(=O)O)CC3)c(C(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C22H31N3O2/c1-15-5-11-19(12-6-15)25-14-17(20(24-25)22(2,3)4)13-23-18-9-7-16(8-10-18)21(26)27/h5-6,11-12,14,16,18,23H,7-10,13H2,1-4H3,(H,26,27) |
| InChIKey | XRASDDCUDYCEGK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |