C26H34N4O2 — CID 56852816
[1-[3-[[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]methylamino]propyl]piperidin-2-yl]methanol (PubChem CID 56852816) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is [1-[3-[[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]methylamino]propyl]piperidin-2-yl]methanol.
| Compound Name | [1-[3-[[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]methylamino]propyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 56852816 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | [1-[3-[[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]methylamino]propyl]piperidin-2-yl]methanol |
| SMILES | COc1cccc(-c2nn(-c3ccccc3)cc2CNCCCN2CCCCC2CO)c1 |
| InChI | InChI=1S/C26H34N4O2/c1-32-25-13-7-9-21(17-25)26-22(19-30(28-26)23-10-3-2-4-11-23)18-27-14-8-16-29-15-6-5-12-24(29)20-31/h2-4,7,9-11,13,17,19,24,27,31H,5-6,8,12,14-16,18,20H2,1H3 |
| InChIKey | TUIQMTCZBYPNIQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|