C21H18FN3S — CID 26690499
N-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-thiophen-3-ylmethanamine (PubChem CID 26690499) has the molecular formula C21H18FN3S and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-thiophen-3-ylmethanamine.
| Compound Name | N-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 26690499 |
| Molecular Formula | C21H18FN3S |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-thiophen-3-ylmethanamine |
| SMILES | Fc1ccc(-c2nn(-c3ccccc3)cc2CNCc2ccsc2)cc1 |
| InChI | InChI=1S/C21H18FN3S/c22-19-8-6-17(7-9-19)21-18(13-23-12-16-10-11-26-15-16)14-25(24-21)20-4-2-1-3-5-20/h1-11,14-15,23H,12-13H2 |
| InChIKey | CSXVAFNOYHXRHV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |