C23H28N4O — CID 135684895
5-(diethylamino)-2-[(E)-[(4,6,8-trimethylquinolin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 135684895) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(E)-[(4,6,8-trimethylquinolin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 5-(diethylamino)-2-[(E)-[(4,6,8-trimethylquinolin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135684895 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 5-(diethylamino)-2-[(E)-[(4,6,8-trimethylquinolin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | CCN(CC)c1ccc(/C=N/Nc2cc(C)c3cc(C)cc(C)c3n2)c(O)c1 |
| InChI | InChI=1S/C23H28N4O/c1-6-27(7-2)19-9-8-18(21(28)13-19)14-24-26-22-12-16(4)20-11-15(3)10-17(5)23(20)25-22/h8-14,28H,6-7H2,1-5H3,(H,25,26)/b24-14+ |
| InChIKey | BYGIGDVEMUYDHB-ZVHZXABRSA-N |
| XLogP | 5.16 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|