C20H22N6O — CID 137296033
2-[2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-5,6-dimethylpyridine-3,4-dicarbonitrile (PubChem CID 137296033) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 2-[2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-5,6-dimethylpyridine-3,4-dicarbonitrile.
| Compound Name | 2-[2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-5,6-dimethylpyridine-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 137296033 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-[2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-5,6-dimethylpyridine-3,4-dicarbonitrile |
| SMILES | CCN(CC)c1ccc(C=NNc2nc(C)c(C)c(C#N)c2C#N)c(O)c1 |
| InChI | InChI=1S/C20H22N6O/c1-5-26(6-2)16-8-7-15(19(27)9-16)12-23-25-20-18(11-22)17(10-21)13(3)14(4)24-20/h7-9,12,27H,5-6H2,1-4H3,(H,24,25) |
| InChIKey | PMJZROKZHSEARE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|