C21H15Cl2N5 — CID 75362969
2,6-dichloro-N-[(E)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]aniline (PubChem CID 75362969) has the molecular formula C21H15Cl2N5 and a molecular weight of 408.29 g/mol. Its IUPAC name is 2,6-dichloro-N-[(E)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]aniline.
| Compound Name | 2,6-dichloro-N-[(E)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 75362969 |
| Molecular Formula | C21H15Cl2N5 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2,6-dichloro-N-[(E)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]aniline |
| SMILES | Clc1cccc(Cl)c1N/N=C/c1cn(-c2ccccc2)nc1-c1ccncc1 |
| InChI | InChI=1S/C21H15Cl2N5/c22-18-7-4-8-19(23)21(18)26-25-13-16-14-28(17-5-2-1-3-6-17)27-20(16)15-9-11-24-12-10-15/h1-14,26H/b25-13+ |
| InChIKey | FVXOMKAXJOBZJF-DHRITJCHSA-N |
| XLogP | 5.69 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|