C14H8Br3N3O5 — CID 137173005
3,5-dibromo-N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-4-hydroxybenzamide (PubChem CID 137173005) has the molecular formula C14H8Br3N3O5 and a molecular weight of 537.95 g/mol. Its IUPAC name is 3,5-dibromo-N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3,5-dibromo-N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 137173005 |
| Molecular Formula | C14H8Br3N3O5 |
| Molecular Weight | 537.95 g/mol |
| Exact Mass | 534.80 |
| IUPAC Name | 3,5-dibromo-N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(N/N=C\c1cc([N+](=O)[O-])cc(Br)c1O)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C14H8Br3N3O5/c15-9-2-6(3-10(16)13(9)22)14(23)19-18-5-7-1-8(20(24)25)4-11(17)12(7)21/h1-5,21-22H,(H,19,23)/b18-5- |
| InChIKey | LAJQTVVPVUAITM-DVZOWYKESA-N |
| XLogP | 4.06 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.95 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|