C20H17BrN4O4 — CID 137076615
N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-(2,5-dimethylpyrrol-1-yl)benzamide (PubChem CID 137076615) has the molecular formula C20H17BrN4O4 and a molecular weight of 457.28 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-(2,5-dimethylpyrrol-1-yl)benzamide.
| Compound Name | N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-(2,5-dimethylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 137076615 |
| Molecular Formula | C20H17BrN4O4 |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-(2,5-dimethylpyrrol-1-yl)benzamide |
| SMILES | Cc1ccc(C)n1-c1cccc(C(=O)N/N=C\c2cc([N+](=O)[O-])cc(Br)c2O)c1 |
| InChI | InChI=1S/C20H17BrN4O4/c1-12-6-7-13(2)24(12)16-5-3-4-14(8-16)20(27)23-22-11-15-9-17(25(28)29)10-18(21)19(15)26/h3-11,26H,1-2H3,(H,23,27)/b22-11- |
| InChIKey | HHKMHDFZVIISTL-JJFYIABZSA-N |
| XLogP | 4.23 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|