C14H10BrN3O5 — CID 137122752
N-[(Z)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-3-nitrobenzamide (PubChem CID 137122752) has the molecular formula C14H10BrN3O5 and a molecular weight of 380.15 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(Z)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 137122752 |
| Molecular Formula | C14H10BrN3O5 |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | N-[(Z)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-3-nitrobenzamide |
| SMILES | O=C(N/N=C\c1cc(Br)c(O)cc1O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10BrN3O5/c15-11-5-9(12(19)6-13(11)20)7-16-17-14(21)8-2-1-3-10(4-8)18(22)23/h1-7,19-20H,(H,17,21)/b16-7- |
| InChIKey | GTKVSQWVJFFMEE-APSNUPSMSA-N |
| XLogP | 2.53 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|