C14H11N3O5 — CID 135504453
N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-nitrobenzamide (PubChem CID 135504453) has the molecular formula C14H11N3O5 and a molecular weight of 301.26 g/mol. Its IUPAC name is N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 135504453 |
| Molecular Formula | C14H11N3O5 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-nitrobenzamide |
| SMILES | O=C(N/N=C/c1ccc(O)c(O)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11N3O5/c18-12-5-4-9(6-13(12)19)8-15-16-14(20)10-2-1-3-11(7-10)17(21)22/h1-8,18-19H,(H,16,20)/b15-8+ |
| InChIKey | ZXDFXUDRSGQHHY-OVCLIPMQSA-N |
| XLogP | 1.77 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|