C22H18FN3O2S — CID 94845074
N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 94845074) has the molecular formula C22H18FN3O2S and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 94845074 |
| Molecular Formula | C22H18FN3O2S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | COc1cc(/C=N\Nc2nc3ccccc3s2)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C22H18FN3O2S/c1-27-20-12-15(10-11-19(20)28-14-16-6-2-3-7-17(16)23)13-24-26-22-25-18-8-4-5-9-21(18)29-22/h2-13H,14H2,1H3,(H,25,26)/b24-13- |
| InChIKey | CQDQPWCBDSXYDI-CFRMEGHHSA-N |
| XLogP | 5.47 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|