C24H23N3O3S — CID 6066301
N-[(Z)-[3-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 6066301) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[(Z)-[3-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-[3-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 6066301 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-[(Z)-[3-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | COc1cccc(OCCCOc2cccc(/C=N\Nc3nc4ccccc4s3)c2)c1 |
| InChI | InChI=1S/C24H23N3O3S/c1-28-19-8-5-10-21(16-19)30-14-6-13-29-20-9-4-7-18(15-20)17-25-27-24-26-22-11-2-3-12-23(22)31-24/h2-5,7-12,15-17H,6,13-14H2,1H3,(H,26,27)/b25-17- |
| InChIKey | KSIONBJPBMFFLC-UQQQWYQISA-N |
| XLogP | 5.60 |
| TPSA | 64.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|