C19H18N8O2S2 — CID 17048832
2-[[4-amino-5-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide (PubChem CID 17048832) has the molecular formula C19H18N8O2S2 and a molecular weight of 454.54 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17048832 |
| Molecular Formula | C19H18N8O2S2 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide |
| SMILES | COc1cccc(/C=N/Nc2nnc(SCC(=O)Nc3nc4ccccc4s3)n2N)c1 |
| InChI | InChI=1S/C19H18N8O2S2/c1-29-13-6-4-5-12(9-13)10-21-24-17-25-26-19(27(17)20)30-11-16(28)23-18-22-14-7-2-3-8-15(14)31-18/h2-10H,11,20H2,1H3,(H,24,25)(H,22,23,28)/b21-10+ |
| InChIKey | BAQNBIUPJYYORO-UFFVCSGVSA-N |
| XLogP | 2.79 |
| TPSA | 132.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|