C25H25N3O4S — CID 6891729
N-[(E)-[3,5-dimethoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 6891729) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[(E)-[3,5-dimethoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-[3,5-dimethoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 6891729 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-[(E)-[3,5-dimethoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | COc1cc(/C=N/Nc2nc3ccccc3s2)cc(OC)c1OCCOc1cccc(C)c1 |
| InChI | InChI=1S/C25H25N3O4S/c1-17-7-6-8-19(13-17)31-11-12-32-24-21(29-2)14-18(15-22(24)30-3)16-26-28-25-27-20-9-4-5-10-23(20)33-25/h4-10,13-16H,11-12H2,1-3H3,(H,27,28)/b26-16+ |
| InChIKey | JBLPKKIWFLLGEF-WGOQTCKBSA-N |
| XLogP | 5.53 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|