C21H18N4O5S2 — CID 35581452
[4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-ethoxyphenyl] 2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 35581452) has the molecular formula C21H18N4O5S2 and a molecular weight of 470.53 g/mol. Its IUPAC name is [4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-ethoxyphenyl] 2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | [4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-ethoxyphenyl] 2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 35581452 |
| Molecular Formula | C21H18N4O5S2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | [4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-ethoxyphenyl] 2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | CCOc1cc(/C=N\Nc2nc3ccccc3s2)ccc1OC(=O)C[C@@H]1SC(=O)NC1=O |
| InChI | InChI=1S/C21H18N4O5S2/c1-2-29-15-9-12(11-22-25-20-23-13-5-3-4-6-16(13)31-20)7-8-14(15)30-18(26)10-17-19(27)24-21(28)32-17/h3-9,11,17H,2,10H2,1H3,(H,23,25)(H,24,27,28)/b22-11-/t17-/m0/s1 |
| InChIKey | GTOZDWJBFDBPIP-SXOHWRJOSA-N |
| XLogP | 3.79 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|