C20H16N4O5S2 — CID 35581458
[4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-methoxyphenyl] 2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 35581458) has the molecular formula C20H16N4O5S2 and a molecular weight of 456.51 g/mol. Its IUPAC name is [4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-methoxyphenyl] 2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | [4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-methoxyphenyl] 2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 35581458 |
| Molecular Formula | C20H16N4O5S2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | [4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-methoxyphenyl] 2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | COc1cc(/C=N\Nc2nc3ccccc3s2)ccc1OC(=O)C[C@H]1SC(=O)NC1=O |
| InChI | InChI=1S/C20H16N4O5S2/c1-28-14-8-11(10-21-24-19-22-12-4-2-3-5-15(12)30-19)6-7-13(14)29-17(25)9-16-18(26)23-20(27)31-16/h2-8,10,16H,9H2,1H3,(H,22,24)(H,23,26,27)/b21-10-/t16-/m1/s1 |
| InChIKey | KDKTYXJSMUCYRC-LIQPLZLLSA-N |
| XLogP | 3.40 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|