C22H18N4O6S3 — CID 3479448
[4-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate (PubChem CID 3479448) has the molecular formula C22H18N4O6S3 and a molecular weight of 530.61 g/mol. Its IUPAC name is [4-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate.
| Compound Name | [4-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate |
|---|---|
| PubChem CID | 3479448 |
| Molecular Formula | C22H18N4O6S3 |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | [4-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate |
| SMILES | COc1cc(C=NNC(=O)CSc2nc3ccccc3s2)ccc1OC(=O)CC1SC(=O)NC1=O |
| InChI | InChI=1S/C22H18N4O6S3/c1-31-15-8-12(6-7-14(15)32-19(28)9-17-20(29)25-21(30)34-17)10-23-26-18(27)11-33-22-24-13-4-2-3-5-16(13)35-22/h2-8,10,17H,9,11H2,1H3,(H,26,27)(H,25,29,30) |
| InChIKey | OQOSFICKEXFOCB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|