C17H21N2O3S- — CID 9155815
2-[2-[2-(3-methyl-4-propan-2-ylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 9155815) has the molecular formula C17H21N2O3S- and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-[2-[2-(3-methyl-4-propan-2-ylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[2-(3-methyl-4-propan-2-ylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 9155815 |
| Molecular Formula | C17H21N2O3S- |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[2-[2-(3-methyl-4-propan-2-ylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1cc(OCCNc2nc(CC(=O)[O-])cs2)ccc1C(C)C |
| InChI | InChI=1S/C17H22N2O3S/c1-11(2)15-5-4-14(8-12(15)3)22-7-6-18-17-19-13(10-23-17)9-16(20)21/h4-5,8,10-11H,6-7,9H2,1-3H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | LTSGFVXDXZZKHE-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|