C14H14NO3S- — CID 7745392
2-[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]acetate (PubChem CID 7745392) has the molecular formula C14H14NO3S- and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 7745392 |
| Molecular Formula | C14H14NO3S- |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1ccc(OCc2nc(CC(=O)[O-])cs2)cc1C |
| InChI | InChI=1S/C14H15NO3S/c1-9-3-4-12(5-10(9)2)18-7-13-15-11(8-19-13)6-14(16)17/h3-5,8H,6-7H2,1-2H3,(H,16,17)/p-1 |
| InChIKey | MYBWQXZUHDFUNZ-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |