C19H25N3O2S — CID 46009691
1-[[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-3-ethyl-1-prop-2-enylurea (PubChem CID 46009691) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-[[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-3-ethyl-1-prop-2-enylurea.
| Compound Name | 1-[[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-3-ethyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 46009691 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-[[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-3-ethyl-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1csc(COc2ccc(C)c(C)c2)n1)C(=O)NCC |
| InChI | InChI=1S/C19H25N3O2S/c1-5-9-22(19(23)20-6-2)11-16-13-25-18(21-16)12-24-17-8-7-14(3)15(4)10-17/h5,7-8,10,13H,1,6,9,11-12H2,2-4H3,(H,20,23) |
| InChIKey | ZIEYCIBHAYRSEM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|