C21H28N2O2S — CID 46009008
N-[[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-3-methyl-N-prop-2-enylbutanamide (PubChem CID 46009008) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is N-[[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-3-methyl-N-prop-2-enylbutanamide.
| Compound Name | N-[[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-3-methyl-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 46009008 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N-[[2-[(3,4-dimethylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-3-methyl-N-prop-2-enylbutanamide |
| SMILES | C=CCN(Cc1csc(COc2ccc(C)c(C)c2)n1)C(=O)CC(C)C |
| InChI | InChI=1S/C21H28N2O2S/c1-6-9-23(21(24)10-15(2)3)12-18-14-26-20(22-18)13-25-19-8-7-16(4)17(5)11-19/h6-8,11,14-15H,1,9-10,12-13H2,2-5H3 |
| InChIKey | BDDPYHCTBORIFS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|