C22H21ClN2O2S — CID 42682463
4-chloro-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylbenzamide (PubChem CID 42682463) has the molecular formula C22H21ClN2O2S and a molecular weight of 412.94 g/mol. Its IUPAC name is 4-chloro-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-chloro-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 42682463 |
| Molecular Formula | C22H21ClN2O2S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 4-chloro-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1csc(COc2cccc(C)c2)n1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O2S/c1-3-11-25(22(26)17-7-9-18(23)10-8-17)13-19-15-28-21(24-19)14-27-20-6-4-5-16(2)12-20/h3-10,12,15H,1,11,13-14H2,2H3 |
| InChIKey | NGWCIMIETZGEMZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|