C22H21FN2O2S — CID 46008823
2-fluoro-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylbenzamide (PubChem CID 46008823) has the molecular formula C22H21FN2O2S and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-fluoro-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylbenzamide.
| Compound Name | 2-fluoro-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 46008823 |
| Molecular Formula | C22H21FN2O2S |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-fluoro-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1csc(COc2cccc(C)c2)n1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C22H21FN2O2S/c1-3-11-25(22(26)19-9-4-5-10-20(19)23)13-17-15-28-21(24-17)14-27-18-8-6-7-16(2)12-18/h3-10,12,15H,1,11,13-14H2,2H3 |
| InChIKey | YXHRYMVCDBPBQS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|