C23H25FN2O3S — CID 46008783
4-fluoro-N-(3-methoxypropyl)-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]benzamide (PubChem CID 46008783) has the molecular formula C23H25FN2O3S and a molecular weight of 428.53 g/mol. Its IUPAC name is 4-fluoro-N-(3-methoxypropyl)-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]benzamide.
| Compound Name | 4-fluoro-N-(3-methoxypropyl)-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 46008783 |
| Molecular Formula | C23H25FN2O3S |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-fluoro-N-(3-methoxypropyl)-N-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]benzamide |
| SMILES | COCCCN(Cc1csc(COc2cccc(C)c2)n1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H25FN2O3S/c1-17-5-3-6-21(13-17)29-15-22-25-20(16-30-22)14-26(11-4-12-28-2)23(27)18-7-9-19(24)10-8-18/h3,5-10,13,16H,4,11-12,14-15H2,1-2H3 |
| InChIKey | NGCCPHTYPOLTLC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|