C22H23BrN2O3S — CID 46009243
3-bromo-N-(3-methoxypropyl)-N-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]benzamide (PubChem CID 46009243) has the molecular formula C22H23BrN2O3S and a molecular weight of 475.41 g/mol. Its IUPAC name is 3-bromo-N-(3-methoxypropyl)-N-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]benzamide.
| Compound Name | 3-bromo-N-(3-methoxypropyl)-N-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 46009243 |
| Molecular Formula | C22H23BrN2O3S |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 3-bromo-N-(3-methoxypropyl)-N-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]benzamide |
| SMILES | COCCCN(Cc1csc(COc2ccccc2)n1)C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C22H23BrN2O3S/c1-27-12-6-11-25(22(26)17-7-5-8-18(23)13-17)14-19-16-29-21(24-19)15-28-20-9-3-2-4-10-20/h2-5,7-10,13,16H,6,11-12,14-15H2,1H3 |
| InChIKey | KMLDKEDCKFAPSC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|