C22H22ClFN2O3S — CID 42682425
N-[[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl]-4-fluoro-N-(3-methoxypropyl)benzamide (PubChem CID 42682425) has the molecular formula C22H22ClFN2O3S and a molecular weight of 448.95 g/mol. Its IUPAC name is N-[[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl]-4-fluoro-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl]-4-fluoro-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 42682425 |
| Molecular Formula | C22H22ClFN2O3S |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-[[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl]-4-fluoro-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(Cc1csc(COc2ccc(Cl)cc2)n1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22ClFN2O3S/c1-28-12-2-11-26(22(27)16-3-7-18(24)8-4-16)13-19-15-30-21(25-19)14-29-20-9-5-17(23)6-10-20/h3-10,15H,2,11-14H2,1H3 |
| InChIKey | LTUPZOYVXYHWEC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|