C18H24N2O3S — CID 24714209
N-(3-methoxypropyl)-N-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]propanamide (PubChem CID 24714209) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]propanamide.
| Compound Name | N-(3-methoxypropyl)-N-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 24714209 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(3-methoxypropyl)-N-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]propanamide |
| SMILES | CCC(=O)N(CCCOC)Cc1csc(COc2ccccc2)n1 |
| InChI | InChI=1S/C18H24N2O3S/c1-3-18(21)20(10-7-11-22-2)12-15-14-24-17(19-15)13-23-16-8-5-4-6-9-16/h4-6,8-9,14H,3,7,10-13H2,1-2H3 |
| InChIKey | WFNUNBMHZFUJLK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|