C21H31N3O3S — CID 46009673
3-tert-butyl-1-(3-methoxypropyl)-1-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]urea (PubChem CID 46009673) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is 3-tert-butyl-1-(3-methoxypropyl)-1-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]urea.
| Compound Name | 3-tert-butyl-1-(3-methoxypropyl)-1-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]urea |
|---|---|
| PubChem CID | 46009673 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 3-tert-butyl-1-(3-methoxypropyl)-1-[[2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]urea |
| SMILES | COCCCN(Cc1csc(COc2cccc(C)c2)n1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H31N3O3S/c1-16-8-6-9-18(12-16)27-14-19-22-17(15-28-19)13-24(10-7-11-26-5)20(25)23-21(2,3)4/h6,8-9,12,15H,7,10-11,13-14H2,1-5H3,(H,23,25) |
| InChIKey | ZDAGMKFKAOGDCK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|