C14H15ClN2O3S — CID 9155942
2-[2-[2-(4-chloro-3-methylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 9155942) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 2-[2-[2-(4-chloro-3-methylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[2-(4-chloro-3-methylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 9155942 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-[2-[2-(4-chloro-3-methylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | Cc1cc(OCCNc2nc(CC(=O)O)cs2)ccc1Cl |
| InChI | InChI=1S/C14H15ClN2O3S/c1-9-6-11(2-3-12(9)15)20-5-4-16-14-17-10(8-21-14)7-13(18)19/h2-3,6,8H,4-5,7H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | SKGDYHJMNBHTKU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|