C13H11Cl2N2O3S- — CID 9155837
2-[2-[2-(2,5-dichlorophenoxy)ethylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 9155837) has the molecular formula C13H11Cl2N2O3S- and a molecular weight of 346.22 g/mol. Its IUPAC name is 2-[2-[2-(2,5-dichlorophenoxy)ethylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[2-(2,5-dichlorophenoxy)ethylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 9155837 |
| Molecular Formula | C13H11Cl2N2O3S- |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 2-[2-[2-(2,5-dichlorophenoxy)ethylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | O=C([O-])Cc1csc(NCCOc2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C13H12Cl2N2O3S/c14-8-1-2-10(15)11(5-8)20-4-3-16-13-17-9(7-21-13)6-12(18)19/h1-2,5,7H,3-4,6H2,(H,16,17)(H,18,19)/p-1 |
| InChIKey | WXHQFSZDNIDJFE-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|