C25H30N2O3S — CID 19196934
N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(3-methyl-4-propan-2-ylphenoxy)acetamide (PubChem CID 19196934) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(3-methyl-4-propan-2-ylphenoxy)acetamide.
| Compound Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(3-methyl-4-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 19196934 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(3-methyl-4-propan-2-ylphenoxy)acetamide |
| SMILES | CCCCOc1ccc(-c2csc(NC(=O)COc3ccc(C(C)C)c(C)c3)n2)cc1 |
| InChI | InChI=1S/C25H30N2O3S/c1-5-6-13-29-20-9-7-19(8-10-20)23-16-31-25(26-23)27-24(28)15-30-21-11-12-22(17(2)3)18(4)14-21/h7-12,14,16-17H,5-6,13,15H2,1-4H3,(H,26,27,28) |
| InChIKey | USRHXKJKEMIQPF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|