C11H8FIN2O2S — CID 80576564
2-[2-(4-fluoro-2-iodoanilino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 80576564) has the molecular formula C11H8FIN2O2S and a molecular weight of 378.17 g/mol. Its IUPAC name is 2-[2-(4-fluoro-2-iodoanilino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(4-fluoro-2-iodoanilino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 80576564 |
| Molecular Formula | C11H8FIN2O2S |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 2-[2-(4-fluoro-2-iodoanilino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(Nc2ccc(F)cc2I)n1 |
| InChI | InChI=1S/C11H8FIN2O2S/c12-6-1-2-9(8(13)3-6)15-11-14-7(5-18-11)4-10(16)17/h1-3,5H,4H2,(H,14,15)(H,16,17) |
| InChIKey | QKVNCTYNOSJCLM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|