C9H5ClFIN2S — CID 83155997
4-chloro-N-(4-fluoro-2-iodophenyl)-1,3-thiazol-2-amine (PubChem CID 83155997) has the molecular formula C9H5ClFIN2S and a molecular weight of 354.58 g/mol. Its IUPAC name is 4-chloro-N-(4-fluoro-2-iodophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-N-(4-fluoro-2-iodophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 83155997 |
| Molecular Formula | C9H5ClFIN2S |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 353.89 |
| IUPAC Name | 4-chloro-N-(4-fluoro-2-iodophenyl)-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(Nc2nc(Cl)cs2)c(I)c1 |
| InChI | InChI=1S/C9H5ClFIN2S/c10-8-4-15-9(14-8)13-7-2-1-5(11)3-6(7)12/h1-4H,(H,13,14) |
| InChIKey | UNGFXGZQQIJDAP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|