C11H11ClN2S — CID 83153410
4-chloro-N-(2,4-dimethylphenyl)-1,3-thiazol-2-amine (PubChem CID 83153410) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 4-chloro-N-(2,4-dimethylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-N-(2,4-dimethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 83153410 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 4-chloro-N-(2,4-dimethylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(Nc2nc(Cl)cs2)c(C)c1 |
| InChI | InChI=1S/C11H11ClN2S/c1-7-3-4-9(8(2)5-7)13-11-14-10(12)6-15-11/h3-6H,1-2H3,(H,13,14) |
| InChIKey | SADCZKCBOQPGKH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |