C13H17N3S — CID 28711219
4-(2-aminoethyl)-N-(2,4-dimethylphenyl)-1,3-thiazol-2-amine (PubChem CID 28711219) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-(2,4-dimethylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-aminoethyl)-N-(2,4-dimethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 28711219 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-(2-aminoethyl)-N-(2,4-dimethylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(Nc2nc(CCN)cs2)c(C)c1 |
| InChI | InChI=1S/C13H17N3S/c1-9-3-4-12(10(2)7-9)16-13-15-11(5-6-14)8-17-13/h3-4,7-8H,5-6,14H2,1-2H3,(H,15,16) |
| InChIKey | DYHZUJSLJDNCAL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |